C29H18N2O6 — CID 3285684
3-[[2-(3-benzoylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 3285684) has the molecular formula C29H18N2O6 and a molecular weight of 490.47 g/mol. Its IUPAC name is 3-[[2-(3-benzoylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[2-(3-benzoylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3285684 |
| Molecular Formula | C29H18N2O6 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-[[2-(3-benzoylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(c2cccc(C(=O)c4ccccc4)c2)C3=O)c1 |
| InChI | InChI=1S/C29H18N2O6/c32-25(17-6-2-1-3-7-17)18-8-5-11-22(15-18)31-27(34)23-13-12-19(16-24(23)28(31)35)26(33)30-21-10-4-9-20(14-21)29(36)37/h1-16H,(H,30,33)(H,36,37) |
| InChIKey | XVAUTGDNDZCBAV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|