C21H13NO4 — CID 761887
5-benzoyl-2-(3-hydroxyphenyl)isoindole-1,3-dione (PubChem CID 761887) has the molecular formula C21H13NO4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 5-benzoyl-2-(3-hydroxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-benzoyl-2-(3-hydroxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 761887 |
| Molecular Formula | C21H13NO4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 5-benzoyl-2-(3-hydroxyphenyl)isoindole-1,3-dione |
| SMILES | O=C(c1ccccc1)c1ccc2c(c1)C(=O)N(c1cccc(O)c1)C2=O |
| InChI | InChI=1S/C21H13NO4/c23-16-8-4-7-15(12-16)22-20(25)17-10-9-14(11-18(17)21(22)26)19(24)13-5-2-1-3-6-13/h1-12,23H |
| InChIKey | WHAIFVKUTLUQRF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|