C23H13NO7 — CID 57076792
4-(1,3-dioxo-2-phenylisoindole-5-carbonyl)phthalic acid (PubChem CID 57076792) has the molecular formula C23H13NO7 and a molecular weight of 415.36 g/mol. Its IUPAC name is 4-(1,3-dioxo-2-phenylisoindole-5-carbonyl)phthalic acid.
| Compound Name | 4-(1,3-dioxo-2-phenylisoindole-5-carbonyl)phthalic acid |
|---|---|
| PubChem CID | 57076792 |
| Molecular Formula | C23H13NO7 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 4-(1,3-dioxo-2-phenylisoindole-5-carbonyl)phthalic acid |
| SMILES | O=C(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc2c(c1)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C23H13NO7/c25-19(13-7-9-16(22(28)29)18(11-13)23(30)31)12-6-8-15-17(10-12)21(27)24(20(15)26)14-4-2-1-3-5-14/h1-11H,(H,28,29)(H,30,31) |
| InChIKey | ZPUOOCBZASURTA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|