C23H20N2O7 — CID 177481847
4-[2-(4-aminocyclohexyl)-1,3-dioxoisoindole-5-carbonyl]phthalic acid (PubChem CID 177481847) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is 4-[2-(4-aminocyclohexyl)-1,3-dioxoisoindole-5-carbonyl]phthalic acid.
| Compound Name | 4-[2-(4-aminocyclohexyl)-1,3-dioxoisoindole-5-carbonyl]phthalic acid |
|---|---|
| PubChem CID | 177481847 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-[2-(4-aminocyclohexyl)-1,3-dioxoisoindole-5-carbonyl]phthalic acid |
| SMILES | NC1CCC(N2C(=O)c3ccc(C(=O)c4ccc(C(=O)O)c(C(=O)O)c4)cc3C2=O)CC1 |
| InChI | InChI=1S/C23H20N2O7/c24-13-3-5-14(6-4-13)25-20(27)15-7-1-11(9-17(15)21(25)28)19(26)12-2-8-16(22(29)30)18(10-12)23(31)32/h1-2,7-10,13-14H,3-6,24H2,(H,29,30)(H,31,32) |
| InChIKey | ZJQKJLWSCBWFBV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|