C17H18N2O5 — CID 119171454
2-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]acetic acid (PubChem CID 119171454) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]acetic acid.
| Compound Name | 2-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 119171454 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C17H18N2O5/c20-14(21)9-18-15(22)10-6-7-12-13(8-10)17(24)19(16(12)23)11-4-2-1-3-5-11/h6-8,11H,1-5,9H2,(H,18,22)(H,20,21) |
| InChIKey | GMSBPNHNZCMNEG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|