C24H25N3O5 — CID 108540023
2-cyclohexyl-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108540023) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-cyclohexyl-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108540023 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-cyclohexyl-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C24H25N3O5/c28-20-9-5-4-8-18(20)22(30)26-13-12-25-21(29)15-10-11-17-19(14-15)24(32)27(23(17)31)16-6-2-1-3-7-16/h4-5,8-11,14,16,28H,1-3,6-7,12-13H2,(H,25,29)(H,26,30) |
| InChIKey | FOYFKVKRTFTYTJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|