C19H26ClN3O3 — CID 119627052
N-(2-amino-2-methylpropyl)-2-cyclohexyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride (PubChem CID 119627052) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2-cyclohexyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-2-cyclohexyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119627052 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2-cyclohexyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
| SMILES | CC(C)(N)CNC(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O.Cl |
| InChI | InChI=1S/C19H25N3O3.ClH/c1-19(2,20)11-21-16(23)12-8-9-14-15(10-12)18(25)22(17(14)24)13-6-4-3-5-7-13;/h8-10,13H,3-7,11,20H2,1-2H3,(H,21,23);1H |
| InChIKey | BVOSWPMAFZDWNV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|