C17H17NO4 — CID 75417597
1-cyclopropylethyl 2-cyclopropyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 75417597) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-cyclopropylethyl 2-cyclopropyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 1-cyclopropylethyl 2-cyclopropyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 75417597 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-cyclopropylethyl 2-cyclopropyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1)C(=O)N(C1CC1)C2=O)C1CC1 |
| InChI | InChI=1S/C17H17NO4/c1-9(10-2-3-10)22-17(21)11-4-7-13-14(8-11)16(20)18(15(13)19)12-5-6-12/h4,7-10,12H,2-3,5-6H2,1H3 |
| InChIKey | PCWNNCXKDJRSEW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|