C26H26N2O5 — CID 55392006
[2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55392006) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55392006 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OC(C(=O)NC1CC1)c1ccccc1)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C26H26N2O5/c29-23(27-18-12-13-18)22(16-7-3-1-4-8-16)33-26(32)17-11-14-20-21(15-17)25(31)28(24(20)30)19-9-5-2-6-10-19/h1,3-4,7-8,11,14-15,18-19,22H,2,5-6,9-10,12-13H2,(H,27,29) |
| InChIKey | PLQZDJCGAHWZKI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|