C19H16F3NO3 — CID 9415143
[(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-(trifluoromethyl)benzoate (PubChem CID 9415143) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 9415143 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(O[C@@H](C(=O)NC1CC1)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3NO3/c20-19(21,22)14-8-6-13(7-9-14)18(25)26-16(12-4-2-1-3-5-12)17(24)23-15-10-11-15/h1-9,15-16H,10-11H2,(H,23,24)/t16-/m1/s1 |
| InChIKey | RISWXZJGCFYRHG-MRXNPFEDSA-N |
| XLogP | 3.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |