C19H19NO4 — CID 9414934
[(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] (2S)-2-hydroxy-2-phenylacetate (PubChem CID 9414934) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] (2S)-2-hydroxy-2-phenylacetate.
| Compound Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] (2S)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 9414934 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] (2S)-2-hydroxy-2-phenylacetate |
| SMILES | O=C(O[C@@H](C(=O)NC1CC1)c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c21-16(13-7-3-1-4-8-13)19(23)24-17(14-9-5-2-6-10-14)18(22)20-15-11-12-15/h1-10,15-17,21H,11-12H2,(H,20,22)/t16-,17+/m0/s1 |
| InChIKey | JNKMIWZTEQXIKJ-DLBZAZTESA-N |
| XLogP | 2.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |