C21H23N3O4 — CID 8938566
[(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate (PubChem CID 8938566) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate.
| Compound Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 8938566 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] (2S)-2-(carbamoylamino)-3-phenylpropanoate |
| SMILES | NC(=O)N[C@@H](Cc1ccccc1)C(=O)O[C@@H](C(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O4/c22-21(27)24-17(13-14-7-3-1-4-8-14)20(26)28-18(15-9-5-2-6-10-15)19(25)23-16-11-12-16/h1-10,16-18H,11-13H2,(H,23,25)(H3,22,24,27)/t17-,18+/m0/s1 |
| InChIKey | LDNRTAXVZKGHRQ-ZWKOTPCHSA-N |
| XLogP | 1.83 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |