C29H32N2O2 — CID 3523242
N-cyclohexyl-2-[(2,2-diphenylacetyl)amino]-3-phenylpropanamide (PubChem CID 3523242) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2,2-diphenylacetyl)amino]-3-phenylpropanamide.
| Compound Name | N-cyclohexyl-2-[(2,2-diphenylacetyl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 3523242 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N-cyclohexyl-2-[(2,2-diphenylacetyl)amino]-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)C(Cc1ccccc1)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32N2O2/c32-28(30-25-19-11-4-12-20-25)26(21-22-13-5-1-6-14-22)31-29(33)27(23-15-7-2-8-16-23)24-17-9-3-10-18-24/h1-3,5-10,13-18,25-27H,4,11-12,19-21H2,(H,30,32)(H,31,33) |
| InChIKey | VGBRODJKNJDXLD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |