C21H30N2O3 — CID 123189621
N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-2-(1-hydroxyethyl)but-3-enamide (PubChem CID 123189621) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-2-(1-hydroxyethyl)but-3-enamide.
| Compound Name | N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-2-(1-hydroxyethyl)but-3-enamide |
|---|---|
| PubChem CID | 123189621 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-2-(1-hydroxyethyl)but-3-enamide |
| SMILES | C=CC(C(=O)NC(Cc1ccccc1)C(=O)NC1CCCCC1)C(C)O |
| InChI | InChI=1S/C21H30N2O3/c1-3-18(15(2)24)20(25)23-19(14-16-10-6-4-7-11-16)21(26)22-17-12-8-5-9-13-17/h3-4,6-7,10-11,15,17-19,24H,1,5,8-9,12-14H2,2H3,(H,22,26)(H,23,25) |
| InChIKey | OHLTXAMNYNISKV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|