C17H23NO4 — CID 135018453
ethyl (2S)-2-[2-(1-hydroxyethyl)but-3-enoylamino]-3-phenylpropanoate (PubChem CID 135018453) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl (2S)-2-[2-(1-hydroxyethyl)but-3-enoylamino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[2-(1-hydroxyethyl)but-3-enoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 135018453 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethyl (2S)-2-[2-(1-hydroxyethyl)but-3-enoylamino]-3-phenylpropanoate |
| SMILES | C=CC(C(=O)N[C@@H](Cc1ccccc1)C(=O)OCC)C(C)O |
| InChI | InChI=1S/C17H23NO4/c1-4-14(12(3)19)16(20)18-15(17(21)22-5-2)11-13-9-7-6-8-10-13/h4,6-10,12,14-15,19H,1,5,11H2,2-3H3,(H,18,20)/t12?,14?,15-/m0/s1 |
| InChIKey | JSIPKIGWEGYFAV-ZALBZXLWSA-N |
| XLogP | 1.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|