C16H20N2O5 — CID 15126521
ethyl (2S)-2-(2-nitropent-4-enoylamino)-3-phenylpropanoate (PubChem CID 15126521) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl (2S)-2-(2-nitropent-4-enoylamino)-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-(2-nitropent-4-enoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 15126521 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl (2S)-2-(2-nitropent-4-enoylamino)-3-phenylpropanoate |
| SMILES | C=CCC(C(=O)N[C@@H](Cc1ccccc1)C(=O)OCC)[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N2O5/c1-3-8-14(18(21)22)15(19)17-13(16(20)23-4-2)11-12-9-6-5-7-10-12/h3,5-7,9-10,13-14H,1,4,8,11H2,2H3,(H,17,19)/t13-,14?/m0/s1 |
| InChIKey | QPVDGJWOMKCEIO-LSLKUGRBSA-N |
| XLogP | 1.50 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|