C26H36N2O5 — CID 143293600
ethyl 3-phenyl-2-[2-(phenylmethoxycarbonylamino)butanoylamino]propanoate;propane (PubChem CID 143293600) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is ethyl 3-phenyl-2-[2-(phenylmethoxycarbonylamino)butanoylamino]propanoate;propane.
| Compound Name | ethyl 3-phenyl-2-[2-(phenylmethoxycarbonylamino)butanoylamino]propanoate;propane |
|---|---|
| PubChem CID | 143293600 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | ethyl 3-phenyl-2-[2-(phenylmethoxycarbonylamino)butanoylamino]propanoate;propane |
| SMILES | CCC.CCOC(=O)C(Cc1ccccc1)NC(=O)C(CC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O5.C3H8/c1-3-19(25-23(28)30-16-18-13-9-6-10-14-18)21(26)24-20(22(27)29-4-2)15-17-11-7-5-8-12-17;1-3-2/h5-14,19-20H,3-4,15-16H2,1-2H3,(H,24,26)(H,25,28);3H2,1-2H3 |
| InChIKey | MARHEGHNRHQBOI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |