C16H21NO6 — CID 10871014
diethyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate (PubChem CID 10871014) has the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. Its IUPAC name is diethyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate.
| Compound Name | diethyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 10871014 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | diethyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate |
| SMILES | CCOC(=O)C[C@H](NC(=O)OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C16H21NO6/c1-3-21-14(18)10-13(15(19)22-4-2)17-16(20)23-11-12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | NXVABRCTKKSASF-ZDUSSCGKSA-N |
| XLogP | 1.80 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|