C21H28N2O9 — CID 54035750
(3S)-4-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]amino]-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 54035750) has the molecular formula C21H28N2O9 and a molecular weight of 452.46 g/mol. Its IUPAC name is (3S)-4-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]amino]-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (3S)-4-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]amino]-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 54035750 |
| Molecular Formula | C21H28N2O9 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (3S)-4-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]amino]-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CCOC(=O)CC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C21H28N2O9/c1-3-30-18(26)11-10-15(20(28)31-4-2)22-19(27)16(12-17(24)25)23-21(29)32-13-14-8-6-5-7-9-14/h5-9,15-16H,3-4,10-13H2,1-2H3,(H,22,27)(H,23,29)(H,24,25)/t15-,16-/m0/s1 |
| InChIKey | LIUSLABNTQYAFB-HOTGVXAUSA-N |
| XLogP | 1.15 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|