C23H34N2O7 — CID 175449754
diethyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanedioate (PubChem CID 175449754) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is diethyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 175449754 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | diethyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C23H34N2O7/c1-6-30-19(26)14-13-17(21(28)31-7-2)24-20(27)18(15-16-11-9-8-10-12-16)25-22(29)32-23(3,4)5/h8-12,17-18H,6-7,13-15H2,1-5H3,(H,24,27)(H,25,29) |
| InChIKey | QDBBQUYDWGRMEG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|