C28H36N2O8 — CID 67675694
dibenzyl (2S)-2-[[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]pentanedioate (PubChem CID 67675694) has the molecular formula C28H36N2O8 and a molecular weight of 528.60 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 67675694 |
| Molecular Formula | C28H36N2O8 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | dibenzyl (2S)-2-[[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]pentanedioate |
| SMILES | COC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H36N2O8/c1-28(2,3)38-27(34)30-23(19-35-4)25(32)29-22(26(33)37-18-21-13-9-6-10-14-21)15-16-24(31)36-17-20-11-7-5-8-12-20/h5-14,22-23H,15-19H2,1-4H3,(H,29,32)(H,30,34)/t22-,23-/m0/s1 |
| InChIKey | VYWLCRHPQPTBOG-GOTSBHOMSA-N |
| XLogP | 3.28 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|