C31H40N2O8 — CID 166879231
dibenzyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxoheptanoyl]amino]pentanedioate (PubChem CID 166879231) has the molecular formula C31H40N2O8 and a molecular weight of 568.67 g/mol. Its IUPAC name is dibenzyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxoheptanoyl]amino]pentanedioate.
| Compound Name | dibenzyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxoheptanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 166879231 |
| Molecular Formula | C31H40N2O8 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | dibenzyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxoheptanoyl]amino]pentanedioate |
| SMILES | CCC(=O)CCC(NC(=O)OC(C)(C)C)C(=O)NC(CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H40N2O8/c1-5-24(34)16-17-25(33-30(38)41-31(2,3)4)28(36)32-26(29(37)40-21-23-14-10-7-11-15-23)18-19-27(35)39-20-22-12-8-6-9-13-22/h6-15,25-26H,5,16-21H2,1-4H3,(H,32,36)(H,33,38) |
| InChIKey | BWEOIBURRKWEDC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|