C26H32N2O6 — CID 166879211
dibenzyl 2-[(2-amino-5-oxoheptanoyl)amino]pentanedioate (PubChem CID 166879211) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is dibenzyl 2-[(2-amino-5-oxoheptanoyl)amino]pentanedioate.
| Compound Name | dibenzyl 2-[(2-amino-5-oxoheptanoyl)amino]pentanedioate |
|---|---|
| PubChem CID | 166879211 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | dibenzyl 2-[(2-amino-5-oxoheptanoyl)amino]pentanedioate |
| SMILES | CCC(=O)CCC(N)C(=O)NC(CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H32N2O6/c1-2-21(29)13-14-22(27)25(31)28-23(26(32)34-18-20-11-7-4-8-12-20)15-16-24(30)33-17-19-9-5-3-6-10-19/h3-12,22-23H,2,13-18,27H2,1H3,(H,28,31) |
| InChIKey | NVNSVMSPPXMRMF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |