C16H23N3O4 — CID 22814955
benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate (PubChem CID 22814955) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate.
| Compound Name | benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 22814955 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate |
| SMILES | CCC(N)C(=O)N[C@H](CCC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C16H23N3O4/c1-2-12(17)16(22)19-13(15(18)21)8-9-14(20)23-10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10,17H2,1H3,(H2,18,21)(H,19,22)/t12?,13-/m1/s1 |
| InChIKey | UDNNDMBCLSNYQE-ZGTCLIOFSA-N |
| XLogP | 0.22 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |