benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate

C16H23N3O4 — CID 22814955

IUPACbenzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate
SMILESCCC(N)C(=O)N[C@H](CCC(=O)OCc1ccccc1)C(N)=O
InChIInChI=1S/C16H23N3O4/c1-2-12(17)16(22)19-13(15(18)21)8-9-14(20)23-10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10,17H2,1H3,(H2,18,21)(H,19,22)/t12?,13-/m1/s1
InChIKeyUDNNDMBCLSNYQE-ZGTCLIOFSA-N
MW321.38 g/mol
LogP0.22
Rot. Bonds9

About benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate

benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate (PubChem CID 22814955) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate.

Molecular Properties

Compound Namebenzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate
PubChem CID22814955
Molecular FormulaC16H23N3O4
Molecular Weight321.38 g/mol
Exact Mass321.17
IUPAC Namebenzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate
SMILESCCC(N)C(=O)N[C@H](CCC(=O)OCc1ccccc1)C(N)=O
InChIInChI=1S/C16H23N3O4/c1-2-12(17)16(22)19-13(15(18)21)8-9-14(20)23-10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10,17H2,1H3,(H2,18,21)(H,19,22)/t12?,13-/m1/s1
InChIKeyUDNNDMBCLSNYQE-ZGTCLIOFSA-N
XLogP0.22
TPSA124.51 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.38
LogP ≤ 50.22
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate?
The IUPAC name of benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate (CID 22814955) is benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate.
What is the SMILES notation for benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate?
The canonical SMILES for benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate is CCC(N)C(=O)N[C@H](CCC(=O)OCc1ccccc1)C(N)=O.
What is the InChIKey of benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate?
The InChIKey is UDNNDMBCLSNYQE-ZGTCLIOFSA-N. The full InChI is InChI=1S/C16H23N3O4/c1-2-12(17)16(22)19-13(15(18)21)8-9-14(20)23-10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10,17H2,1H3,(H2,18,21)(H,19,22)/t12?,13-/m1/s1.
What are the key properties of benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate?
benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate has a molecular weight of 321.38 g/mol, XLogP of 0.22, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (4R)-5-amino-4-(2-aminobutanoylamino)-5-oxopentanoate is sourced from PubChem (CID 22814955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).