C15H21N3O4 — CID 12873811
benzyl (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate (PubChem CID 12873811) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is benzyl (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate.
| Compound Name | benzyl (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 12873811 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | benzyl (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate |
| SMILES | C[C@H](N)C(=O)N[C@H](CCC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C15H21N3O4/c1-10(16)15(21)18-12(14(17)20)7-8-13(19)22-9-11-5-3-2-4-6-11/h2-6,10,12H,7-9,16H2,1H3,(H2,17,20)(H,18,21)/t10-,12+/m0/s1 |
| InChIKey | FWRRPASOIACNMJ-CMPLNLGQSA-N |
| XLogP | -0.17 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |