C15H22N2O3 — CID 143979155
benzyl (4S)-4-amino-5-oxo-5-(propylamino)pentanoate (PubChem CID 143979155) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is benzyl (4S)-4-amino-5-oxo-5-(propylamino)pentanoate.
| Compound Name | benzyl (4S)-4-amino-5-oxo-5-(propylamino)pentanoate |
|---|---|
| PubChem CID | 143979155 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | benzyl (4S)-4-amino-5-oxo-5-(propylamino)pentanoate |
| SMILES | CCCNC(=O)[C@@H](N)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-10-17-15(19)13(16)8-9-14(18)20-11-12-6-4-3-5-7-12/h3-7,13H,2,8-11,16H2,1H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | RVOPNAASEYUSLS-ZDUSSCGKSA-N |
| XLogP | 1.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |