C19H23ClN2O3 — CID 69462227
benzyl 3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate;hydrochloride (PubChem CID 69462227) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is benzyl 3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate;hydrochloride.
| Compound Name | benzyl 3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 69462227 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | benzyl 3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoate;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccc1)C(=O)NCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3.ClH/c20-17(13-15-7-3-1-4-8-15)19(23)21-12-11-18(22)24-14-16-9-5-2-6-10-16;/h1-10,17H,11-14,20H2,(H,21,23);1H/t17-;/m0./s1 |
| InChIKey | NOAVQCZLLISNRY-LMOVPXPDSA-N |
| XLogP | 2.23 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |