C15H23ClN2O3 — CID 119290928
ethyl 4-[[(2S)-2-amino-3-phenylpropanoyl]amino]butanoate;hydrochloride (PubChem CID 119290928) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is ethyl 4-[[(2S)-2-amino-3-phenylpropanoyl]amino]butanoate;hydrochloride.
| Compound Name | ethyl 4-[[(2S)-2-amino-3-phenylpropanoyl]amino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 119290928 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | ethyl 4-[[(2S)-2-amino-3-phenylpropanoyl]amino]butanoate;hydrochloride |
| SMILES | CCOC(=O)CCCNC(=O)[C@@H](N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C15H22N2O3.ClH/c1-2-20-14(18)9-6-10-17-15(19)13(16)11-12-7-4-3-5-8-12;/h3-5,7-8,13H,2,6,9-11,16H2,1H3,(H,17,19);1H/t13-;/m0./s1 |
| InChIKey | ACQVLRYPPNOCLF-ZOWNYOTGSA-N |
| XLogP | 1.44 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|