C19H32N2O — CID 122423651
2-amino-N-decyl-3-phenylpropanamide (PubChem CID 122423651) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-amino-N-decyl-3-phenylpropanamide.
| Compound Name | 2-amino-N-decyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 122423651 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 2-amino-N-decyl-3-phenylpropanamide |
| SMILES | CCCCCCCCCCNC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C19H32N2O/c1-2-3-4-5-6-7-8-12-15-21-19(22)18(20)16-17-13-10-9-11-14-17/h9-11,13-14,18H,2-8,12,15-16,20H2,1H3,(H,21,22) |
| InChIKey | IBNTYEPEBCIFHD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|