C14H19F3N2O — CID 115519520
(2S)-2-amino-3-phenyl-N-(5,5,5-trifluoropentyl)propanamide (PubChem CID 115519520) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is (2S)-2-amino-3-phenyl-N-(5,5,5-trifluoropentyl)propanamide.
| Compound Name | (2S)-2-amino-3-phenyl-N-(5,5,5-trifluoropentyl)propanamide |
|---|---|
| PubChem CID | 115519520 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2S)-2-amino-3-phenyl-N-(5,5,5-trifluoropentyl)propanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O/c15-14(16,17)8-4-5-9-19-13(20)12(18)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,18H2,(H,19,20)/t12-/m0/s1 |
| InChIKey | MJDTUPJNMFJNDO-LBPRGKRZSA-N |
| XLogP | 2.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|