C15H21F3N2O — CID 104984699
(2S)-2-amino-4-phenyl-N-(5,5,5-trifluoropentyl)butanamide (PubChem CID 104984699) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is (2S)-2-amino-4-phenyl-N-(5,5,5-trifluoropentyl)butanamide.
| Compound Name | (2S)-2-amino-4-phenyl-N-(5,5,5-trifluoropentyl)butanamide |
|---|---|
| PubChem CID | 104984699 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (2S)-2-amino-4-phenyl-N-(5,5,5-trifluoropentyl)butanamide |
| SMILES | N[C@@H](CCc1ccccc1)C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O/c16-15(17,18)10-4-5-11-20-14(21)13(19)9-8-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11,19H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | WLSYJKGCDWRWIW-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|