C17H29N3O — CID 134824441
(2S)-2-amino-N-(8-aminooctyl)-3-phenylpropanamide (PubChem CID 134824441) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is (2S)-2-amino-N-(8-aminooctyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-(8-aminooctyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 134824441 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | (2S)-2-amino-N-(8-aminooctyl)-3-phenylpropanamide |
| SMILES | NCCCCCCCCNC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C17H29N3O/c18-12-8-3-1-2-4-9-13-20-17(21)16(19)14-15-10-6-5-7-11-15/h5-7,10-11,16H,1-4,8-9,12-14,18-19H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | JVOIQLDPYZLEKX-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|