C18H30N4O2 — CID 118485925
(2S)-2-amino-N-[2-[6-(methylamino)hexylamino]-2-oxoethyl]-3-phenylpropanamide (PubChem CID 118485925) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[6-(methylamino)hexylamino]-2-oxoethyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[2-[6-(methylamino)hexylamino]-2-oxoethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 118485925 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (2S)-2-amino-N-[2-[6-(methylamino)hexylamino]-2-oxoethyl]-3-phenylpropanamide |
| SMILES | CNCCCCCCNC(=O)CNC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C18H30N4O2/c1-20-11-7-2-3-8-12-21-17(23)14-22-18(24)16(19)13-15-9-5-4-6-10-15/h4-6,9-10,16,20H,2-3,7-8,11-14,19H2,1H3,(H,21,23)(H,22,24)/t16-/m0/s1 |
| InChIKey | ZWQYOTPYCNOXBQ-INIZCTEOSA-N |
| XLogP | 0.57 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|