C12H17ClN2O3 — CID 13131506
methyl 2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetate;hydrochloride (PubChem CID 13131506) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetate;hydrochloride.
| Compound Name | methyl 2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 13131506 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | methyl 2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetate;hydrochloride |
| SMILES | COC(=O)CNC(=O)[C@@H](N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C12H16N2O3.ClH/c1-17-11(15)8-14-12(16)10(13)7-9-5-3-2-4-6-9;/h2-6,10H,7-8,13H2,1H3,(H,14,16);1H/t10-;/m0./s1 |
| InChIKey | VZLMBUDOOLWFBO-PPHPATTJSA-N |
| XLogP | 0.27 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |