C13H18N2O3S — CID 102060390
methyl 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetate (PubChem CID 102060390) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 102060390 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 2-[[(2R)-2-amino-3-benzylsulfanylpropanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@@H](N)CSCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-18-12(16)7-15-13(17)11(14)9-19-8-10-5-3-2-4-6-10/h2-6,11H,7-9,14H2,1H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | KVYHZZIGUBABFI-NSHDSACASA-N |
| XLogP | 0.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |