C15H20N2O4S2 — CID 102043631
methyl 2-[[(2R)-2-acetamido-3-(benzyldisulfanyl)propanoyl]amino]acetate (PubChem CID 102043631) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-acetamido-3-(benzyldisulfanyl)propanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2R)-2-acetamido-3-(benzyldisulfanyl)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 102043631 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | methyl 2-[[(2R)-2-acetamido-3-(benzyldisulfanyl)propanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](CSSCc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C15H20N2O4S2/c1-11(18)17-13(15(20)16-8-14(19)21-2)10-23-22-9-12-6-4-3-5-7-12/h3-7,13H,8-10H2,1-2H3,(H,16,20)(H,17,18)/t13-/m0/s1 |
| InChIKey | WMWAZYZIHKMQIW-ZDUSSCGKSA-N |
| XLogP | 1.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|