C31H37N3O6PS2+ — CID 138522022
[[(2R)-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]methyl-triphenylphosphanium (PubChem CID 138522022) has the molecular formula C31H37N3O6PS2+ and a molecular weight of 642.76 g/mol. Its IUPAC name is [[(2R)-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]methyl-triphenylphosphanium.
| Compound Name | [[(2R)-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 138522022 |
| Molecular Formula | C31H37N3O6PS2+ |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | [[(2R)-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]methyl-triphenylphosphanium |
| SMILES | COC(=O)CNC(=O)[C@H](CSSC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CC[C@H](N)C(=O)OC |
| InChI | InChI=1S/C31H36N3O6PS2/c1-39-29(36)20-33-30(37)27(34-28(35)19-18-26(32)31(38)40-2)21-42-43-22-41(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,26-27H,18-22,32H2,1-2H3,(H-,33,34,35,37)/p+1/t26-,27-/m0/s1 |
| InChIKey | DDKFNIJJAYHYPF-SVBPBHIXSA-O |
| XLogP | 2.37 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|