C35H43BrN3O7PS — CID 138521923
[3-[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-3-oxopropyl]-triphenylphosphanium bromide (PubChem CID 138521923) has the molecular formula C35H43BrN3O7PS and a molecular weight of 760.69 g/mol. Its IUPAC name is [3-[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-3-oxopropyl]-triphenylphosphanium bromide.
| Compound Name | [3-[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-3-oxopropyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 138521923 |
| Molecular Formula | C35H43BrN3O7PS |
| Molecular Weight | 760.69 g/mol |
| Exact Mass | 759.17 |
| IUPAC Name | [3-[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-3-oxopropyl]-triphenylphosphanium bromide |
| SMILES | CCOC(=O)CNC(=O)C(CSC(=O)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCC(N)C(=O)OCC.[Br-] |
| InChI | InChI=1S/C35H42N3O7PS.BrH/c1-3-44-32(40)24-37-34(42)30(38-31(39)21-20-29(36)35(43)45-4-2)25-47-33(41)22-23-46(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28;/h5-19,29-30H,3-4,20-25,36H2,1-2H3,(H-,37,38,39,42);1H |
| InChIKey | OZWCGWVRGNBSAO-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.69 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|