C33H41N3O6PS2+ — CID 138521827
[[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]methyl-triphenylphosphanium (PubChem CID 138521827) has the molecular formula C33H41N3O6PS2+ and a molecular weight of 670.81 g/mol. Its IUPAC name is [[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]methyl-triphenylphosphanium.
| Compound Name | [[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 138521827 |
| Molecular Formula | C33H41N3O6PS2+ |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | [[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]methyl-triphenylphosphanium |
| SMILES | CCOC(=O)CNC(=O)C(CSSC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCC(N)C(=O)OCC |
| InChI | InChI=1S/C33H40N3O6PS2/c1-3-41-31(38)22-35-32(39)29(36-30(37)21-20-28(34)33(40)42-4-2)23-44-45-24-43(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,28-29H,3-4,20-24,34H2,1-2H3,(H-,35,36,37,39)/p+1 |
| InChIKey | RCPBPGKAOQYCQT-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|