C34H43BrN3O6PS2 — CID 138521721
2-[[(2R)-2-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]ethyl-triphenylphosphanium bromide (PubChem CID 138521721) has the molecular formula C34H43BrN3O6PS2 and a molecular weight of 764.74 g/mol. Its IUPAC name is 2-[[(2R)-2-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]ethyl-triphenylphosphanium bromide.
| Compound Name | 2-[[(2R)-2-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]ethyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 138521721 |
| Molecular Formula | C34H43BrN3O6PS2 |
| Molecular Weight | 764.74 g/mol |
| Exact Mass | 763.15 |
| IUPAC Name | 2-[[(2R)-2-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]ethyl-triphenylphosphanium bromide |
| SMILES | CCOC(=O)CNC(=O)[C@H](CSSCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CC[C@H](N)C(=O)OCC.[Br-] |
| InChI | InChI=1S/C34H42N3O6PS2.BrH/c1-3-42-32(39)24-36-33(40)30(37-31(38)21-20-29(35)34(41)43-4-2)25-46-45-23-22-44(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28;/h5-19,29-30H,3-4,20-25,35H2,1-2H3,(H-,36,37,38,40);1H/t29-,30-;/m0./s1 |
| InChIKey | UALYMCCOBRFAPI-PNHSAAKESA-N |
| XLogP | 0.20 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.74 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|