C35H44N4O7PS2+ — CID 138521888
3-[[2-[[(2R)-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]acetyl]amino]propyl-triphenylphosphanium (PubChem CID 138521888) has the molecular formula C35H44N4O7PS2+ and a molecular weight of 727.87 g/mol. Its IUPAC name is 3-[[2-[[(2R)-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]acetyl]amino]propyl-triphenylphosphanium.
| Compound Name | 3-[[2-[[(2R)-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]acetyl]amino]propyl-triphenylphosphanium |
|---|---|
| PubChem CID | 138521888 |
| Molecular Formula | C35H44N4O7PS2+ |
| Molecular Weight | 727.87 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | 3-[[2-[[(2R)-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]acetyl]amino]propyl-triphenylphosphanium |
| SMILES | COC(=O)CNC(=O)[C@H](CSSCC(=O)NCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CC[C@H](N)C(=O)OC |
| InChI | InChI=1S/C35H43N4O7PS2/c1-45-33(42)23-38-34(43)30(39-31(40)20-19-29(36)35(44)46-2)24-48-49-25-32(41)37-21-12-22-47(26-13-6-3-7-14-26,27-15-8-4-9-16-27)28-17-10-5-11-18-28/h3-11,13-18,29-30H,12,19-25,36H2,1-2H3,(H2-,37,38,39,40,41,43)/p+1/t29-,30-/m0/s1 |
| InChIKey | IEQCVSSEVSHTNC-KYJUHHDHSA-O |
| XLogP | 1.92 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.87 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|