C33H41BrN3O6PS2 — CID 169080527
methyl (2S)-2-amino-5-[[(2R)-3-[3-[bromo(triphenyl)-λ5-phosphanyl]propyldisulfanyl]-1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate (PubChem CID 169080527) has the molecular formula C33H41BrN3O6PS2 and a molecular weight of 750.72 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-[[(2R)-3-[3-[bromo(triphenyl)-λ5-phosphanyl]propyldisulfanyl]-1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate.
| Compound Name | methyl (2S)-2-amino-5-[[(2R)-3-[3-[bromo(triphenyl)-λ5-phosphanyl]propyldisulfanyl]-1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 169080527 |
| Molecular Formula | C33H41BrN3O6PS2 |
| Molecular Weight | 750.72 g/mol |
| Exact Mass | 749.14 |
| IUPAC Name | methyl (2S)-2-amino-5-[[(2R)-3-[3-[bromo(triphenyl)-λ5-phosphanyl]propyldisulfanyl]-1-[(2-methoxy-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| SMILES | COC(=O)CNC(=O)[C@H](CSSCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CC[C@H](N)C(=O)OC |
| InChI | InChI=1S/C33H41BrN3O6PS2/c1-42-31(39)23-36-32(40)29(37-30(38)20-19-28(35)33(41)43-2)24-46-45-22-12-21-44(34,25-13-6-3-7-14-25,26-15-8-4-9-16-26)27-17-10-5-11-18-27/h3-11,13-18,28-29H,12,19-24,35H2,1-2H3,(H,36,40)(H,37,38)/t28-,29-/m0/s1 |
| InChIKey | ACPRRGQQSFHJBS-VMPREFPWSA-N |
| XLogP | 3.65 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.72 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|