C36H45BrN3O7PS — CID 138521707
[5-[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-5-oxopentyl]-triphenylphosphanium bromide (PubChem CID 138521707) has the molecular formula C36H45BrN3O7PS and a molecular weight of 774.71 g/mol. Its IUPAC name is [5-[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-5-oxopentyl]-triphenylphosphanium bromide.
| Compound Name | [5-[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-5-oxopentyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 138521707 |
| Molecular Formula | C36H45BrN3O7PS |
| Molecular Weight | 774.71 g/mol |
| Exact Mass | 773.19 |
| IUPAC Name | [5-[2-[(4-amino-5-ethoxy-5-oxopentanoyl)amino]-3-[(2-methoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-5-oxopentyl]-triphenylphosphanium bromide |
| SMILES | CCOC(=O)C(N)CCC(=O)NC(CSC(=O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCC(=O)OC.[Br-] |
| InChI | InChI=1S/C36H44N3O7PS.BrH/c1-3-46-36(44)30(37)22-23-32(40)39-31(35(43)38-25-33(41)45-2)26-48-34(42)21-13-14-24-47(27-15-7-4-8-16-27,28-17-9-5-10-18-28)29-19-11-6-12-20-29;/h4-12,15-20,30-31H,3,13-14,21-26,37H2,1-2H3,(H-,38,39,40,43);1H |
| InChIKey | PAZBHRHGXKDQMY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.71 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|