C36H45N3O7PS+ — CID 138521724
[5-[2-[(4-amino-5-methoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-5-oxopentyl]-triphenylphosphanium (PubChem CID 138521724) has the molecular formula C36H45N3O7PS+ and a molecular weight of 694.81 g/mol. Its IUPAC name is [5-[2-[(4-amino-5-methoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-5-oxopentyl]-triphenylphosphanium.
| Compound Name | [5-[2-[(4-amino-5-methoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-5-oxopentyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 138521724 |
| Molecular Formula | C36H45N3O7PS+ |
| Molecular Weight | 694.81 g/mol |
| Exact Mass | 694.27 |
| IUPAC Name | [5-[2-[(4-amino-5-methoxy-5-oxopentanoyl)amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]sulfanyl-5-oxopentyl]-triphenylphosphanium |
| SMILES | CCOC(=O)CNC(=O)C(CSC(=O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCC(N)C(=O)OC |
| InChI | InChI=1S/C36H44N3O7PS/c1-3-46-33(41)25-38-35(43)31(39-32(40)23-22-30(37)36(44)45-2)26-48-34(42)21-13-14-24-47(27-15-7-4-8-16-27,28-17-9-5-10-18-28)29-19-11-6-12-20-29/h4-12,15-20,30-31H,3,13-14,21-26,37H2,1-2H3,(H-,38,39,40,43)/p+1 |
| InChIKey | REAHYZRVCNFHRE-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.81 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|