C35H45BrN3O6PS2 — CID 138521803
3-[[(2R)-2-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]propyl-triphenylphosphanium bromide (PubChem CID 138521803) has the molecular formula C35H45BrN3O6PS2 and a molecular weight of 778.77 g/mol. Its IUPAC name is 3-[[(2R)-2-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]propyl-triphenylphosphanium bromide.
| Compound Name | 3-[[(2R)-2-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]propyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 138521803 |
| Molecular Formula | C35H45BrN3O6PS2 |
| Molecular Weight | 778.77 g/mol |
| Exact Mass | 777.17 |
| IUPAC Name | 3-[[(2R)-2-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-3-[(2-ethoxy-2-oxoethyl)amino]-3-oxopropyl]disulfanyl]propyl-triphenylphosphanium bromide |
| SMILES | CCOC(=O)CNC(=O)[C@H](CSSCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CC[C@H](N)C(=O)OCC.[Br-] |
| InChI | InChI=1S/C35H44N3O6PS2.BrH/c1-3-43-33(40)25-37-34(41)31(38-32(39)22-21-30(36)35(42)44-4-2)26-47-46-24-14-23-45(27-15-8-5-9-16-27,28-17-10-6-11-18-28)29-19-12-7-13-20-29;/h5-13,15-20,30-31H,3-4,14,21-26,36H2,1-2H3,(H-,37,38,39,41);1H/t30-,31-;/m0./s1 |
| InChIKey | UOSQBFAMOJCAPF-PNXDLZEOSA-N |
| XLogP | 0.59 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.77 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|