C37H47N3O7PS+ — CID 138521870
[5-[[(2S)-1-ethoxy-5-[[(2R)-1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium (PubChem CID 138521870) has the molecular formula C37H47N3O7PS+ and a molecular weight of 708.84 g/mol. Its IUPAC name is [5-[[(2S)-1-ethoxy-5-[[(2R)-1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium.
| Compound Name | [5-[[(2S)-1-ethoxy-5-[[(2R)-1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 138521870 |
| Molecular Formula | C37H47N3O7PS+ |
| Molecular Weight | 708.84 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | [5-[[(2S)-1-ethoxy-5-[[(2R)-1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium |
| SMILES | CCOC(=O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](NC(=O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C37H46N3O7PS/c1-3-46-35(43)26-38-36(44)32(27-49)40-34(42)24-23-31(37(45)47-4-2)39-33(41)22-14-15-25-48(28-16-8-5-9-17-28,29-18-10-6-11-19-29)30-20-12-7-13-21-30/h5-13,16-21,31-32H,3-4,14-15,22-27H2,1-2H3,(H3-,38,39,40,41,42,44,49)/p+1/t31-,32-/m0/s1 |
| InChIKey | AAVUDRBGOAQYBJ-ACHIHNKUSA-O |
| XLogP | 3.07 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|