C37H45BrN3O8PS — CID 160856720
[5-[[1-ethoxy-5-[(6-methoxy-1-nitrososulfanyl-3,6-dioxohexan-2-yl)amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium bromide (PubChem CID 160856720) has the molecular formula C37H45BrN3O8PS and a molecular weight of 802.72 g/mol. Its IUPAC name is [5-[[1-ethoxy-5-[(6-methoxy-1-nitrososulfanyl-3,6-dioxohexan-2-yl)amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium bromide.
| Compound Name | [5-[[1-ethoxy-5-[(6-methoxy-1-nitrososulfanyl-3,6-dioxohexan-2-yl)amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 160856720 |
| Molecular Formula | C37H45BrN3O8PS |
| Molecular Weight | 802.72 g/mol |
| Exact Mass | 801.18 |
| IUPAC Name | [5-[[1-ethoxy-5-[(6-methoxy-1-nitrososulfanyl-3,6-dioxohexan-2-yl)amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium bromide |
| SMILES | CCOC(=O)C(CCC(=O)NC(CSN=O)C(=O)CCC(=O)OC)NC(=O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C37H44N3O8PS.BrH/c1-3-48-37(45)31(22-24-35(43)39-32(27-50-40-46)33(41)23-25-36(44)47-2)38-34(42)21-13-14-26-49(28-15-7-4-8-16-28,29-17-9-5-10-18-29)30-19-11-6-12-20-30;/h4-12,15-20,31-32H,3,13-14,21-27H2,1-2H3,(H-,38,39,42,43);1H |
| InChIKey | RPXSYFONQNMQMN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.72 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|