C38H48BrN2O7PS — CID 158578540
[5-[[(2S)-1-ethoxy-5-[[(2R)-6-ethoxy-3,6-dioxo-1-sulfanylhexan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium bromide (PubChem CID 158578540) has the molecular formula C38H48BrN2O7PS and a molecular weight of 787.75 g/mol. Its IUPAC name is [5-[[(2S)-1-ethoxy-5-[[(2R)-6-ethoxy-3,6-dioxo-1-sulfanylhexan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium bromide.
| Compound Name | [5-[[(2S)-1-ethoxy-5-[[(2R)-6-ethoxy-3,6-dioxo-1-sulfanylhexan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 158578540 |
| Molecular Formula | C38H48BrN2O7PS |
| Molecular Weight | 787.75 g/mol |
| Exact Mass | 786.21 |
| IUPAC Name | [5-[[(2S)-1-ethoxy-5-[[(2R)-6-ethoxy-3,6-dioxo-1-sulfanylhexan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentyl]-triphenylphosphanium bromide |
| SMILES | CCOC(=O)CCC(=O)[C@H](CS)NC(=O)CC[C@H](NC(=O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC.[Br-] |
| InChI | InChI=1S/C38H47N2O7PS.BrH/c1-3-46-37(44)26-24-34(41)33(28-49)40-36(43)25-23-32(38(45)47-4-2)39-35(42)22-14-15-27-48(29-16-8-5-9-17-29,30-18-10-6-11-19-30)31-20-12-7-13-21-31;/h5-13,16-21,32-33H,3-4,14-15,22-28H2,1-2H3,(H2-,39,40,42,43,49);1H/t32-,33-;/m0./s1 |
| InChIKey | LXGLXNBADFJFNC-MLGYITDRSA-N |
| XLogP | 1.31 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.75 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|