C18H25NO5S — CID 45355295
diethyl 2-(3-phenylsulfanylpropanoylamino)pentanedioate (PubChem CID 45355295) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is diethyl 2-(3-phenylsulfanylpropanoylamino)pentanedioate.
| Compound Name | diethyl 2-(3-phenylsulfanylpropanoylamino)pentanedioate |
|---|---|
| PubChem CID | 45355295 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | diethyl 2-(3-phenylsulfanylpropanoylamino)pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)CCSc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C18H25NO5S/c1-3-23-17(21)11-10-15(18(22)24-4-2)19-16(20)12-13-25-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H,19,20) |
| InChIKey | LXBUGVHXAVUKLD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |