C12H17NO3S — CID 65315150
N-(1,3-dihydroxypropan-2-yl)-3-phenylsulfanylpropanamide (PubChem CID 65315150) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-phenylsulfanylpropanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 65315150 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-phenylsulfanylpropanamide |
| SMILES | O=C(CCSc1ccccc1)NC(CO)CO |
| InChI | InChI=1S/C12H17NO3S/c14-8-10(9-15)13-12(16)6-7-17-11-4-2-1-3-5-11/h1-5,10,14-15H,6-9H2,(H,13,16) |
| InChIKey | KGBCFNRDYYHUKL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |